2,4-Diethoxyphenylboronic acid
Catalog No: FT-0697273
CAS No: 1072952-01-2
- Chemical Name: 2,4-Diethoxyphenylboronic acid
- Molecular Formula: C10H15BO4
- Molecular Weight: 210.04
- InChI Key: KTSBUFFGNADTOT-UHFFFAOYSA-N
- InChI: InChI=1S/C10H15BO4/c1-3-14-8-5-6-9(11(12)13)10(7-8)15-4-2/h5-7,12-13H,3-4H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 210.03500 |
| Density: | N/A |
| CAS: | 1072952-01-2 |
| Bolling_Point: | N/A |
| Product_Name: | 2,4-Diethoxyphenylboronic acid |
| Melting_Point: | N/A |
| Flash_Point: | N/A |
| MF: | C10H15BO4 |
| LogP: | 0.16380 |
|---|---|
| PSA: | 58.92000 |
| MF: | C10H15BO4 |
| FW: | 210.03500 |
| Exact_Mass: | 210.10600 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Warning_Statement: | P305 + P351 + P338 |
| Safety_Statements: | H319 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2931900090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)